Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Plumbagin: Difference between pages

(Difference between pages)
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 461404996 of page Plumbagin for the Chem/Drugbox validation project (updated: 'CASNo').
 
m hatnote
 
Line 1: Line 1:
{{for|the mineral known as plombagine|Plumbago (mineral)}}
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Plumbagin|oldid=461404996}} 461404996] of page [[Plumbagin]] with values updated to verified values.}}
{{chembox
{{
| Verifiedfields = changed
| Verifiedfields = changed
| verifiedrevid = 408417931
| verifiedrevid =
| Name = Plumbagin
| Name = Plumbagin
| ImageFile = Plumbagin.PNG
| ImageFile = Plumbagin.PNG
| ImageSize = 180
| ImageSize = 180
| ImageName = Skeletal formula of plumbagin
| ImageName = Skeletal formula of plumbagin
| ImageFile1 = Plumbagin-3D-balls.png
| ImageFile1 = Plumbagin-3D-balls.png
| ImageSize1 = 190
| ImageSize1 = 190
| ImageName1 = Ball-and-stick model of plumbagin
| ImageName1 = Ball-and-stick model of plumbagin
| IUPACName = 5-hydroxy-2-methyl-naphthalene-1,4-dione
| = 5--2--1,4-dione
| OtherNames =
| OtherNames =
| SystematicName =
| Section1 = {{Chembox Identifiers
| Section1 = {{Chembox Identifiers
| IUPHAR_ligand = 7003
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 9790
| ChemSpiderID = 9790
| PubChem = 10205
| PubChem = 10205
Line 26: Line 28:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VCMMXZQDRFWYSE-UHFFFAOYSA-N
| StdInChIKey = VCMMXZQDRFWYSE-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo_Ref = {{cascite|correct|}}
| CASNo = <!-- blanked - oldvalue: 481-42-5 -->
| CASNo = 481-42-5
| ChEBI_Ref = {{ebicite|changed|EBI}}
| = {{||}}
| UNII = YAS4TBQ4OQ
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 8273
| ChEBI = 8273
| SMILES = O=C\2c1c(O)cccc1C(=O)/C(=C/2)C
| SMILES = =O)()C(=)
}}
}}
| Section2 = {{Chembox Properties
| Section2 = {{Chembox Properties
| Formula = C<sub>11</sub>H<sub>8</sub>O<sub>3</sub>
| Formula = C<sub>11</sub>H<sub>8</sub>O<sub>3</sub>
| MolarMass = 188.17942 g/mol
| MolarMass = 188.17942 g/mol
| Density =
| Density =
| MeltingPt =
| MeltingPt =
| BoilingPt =
| BoilingPt =
| Solubility =
| Solubility =
}}
}}
| Section3 =
| Section4 =
| Section5 =
| Section6 =
}}
}}

'''Plumbagin''' or '''5-hydroxy-2-methyl-1,4-naphthoquinone''' is an [[organic compound]] with the [[chemical formula]] {{chem|C|11|H|8|O|3}}. It is regarded as a [[toxin]]<ref name=walnut /> and it is [[Genotoxicity|genotoxic]]<ref>{{Cite journal | journal = Toxicology in Vitro | volume = 23 | issue = 2 | year = 2009 | pages = 266–271 | title = Genotoxicity of plumbagin and its effects on catechol and NQNO-induced DNA damage in mouse lymphoma cells |author1=Jemal Demma |author2=Karl Hallberg |author3=Björn Hellman | doi = 10.1016/j.tiv.2008.12.007| pmid = 19124069 }}</ref> and [[mutagenic]].<ref>{{Cite journal | journal = J Bacteriol | year = 1985 | volume = 164 | issue = 3 | pages = 1309–1316 | pmc = 219331 | title = Toxicity and mutagenicity of plumbagin and the induction of a possible new DNA repair pathway in Escherichia coli |author1=S B Farr |author2=D O Natvig |author3=T Kogoma | doi = 10.1128/JB.164.3.1309-1316.1985 |name-list-style=amp | pmid=2933393}}</ref>

Plumbagin is a yellow [[dye]],<ref name=walnut>[https://www.drugs.com/npp/black-walnut.html Black Walnut]. Drugs.com.</ref> formally derived from [[naphthoquinone]].

It is named after the plant genus ''[[Plumbago]]'', from which it was originally isolated.<ref>{{ cite journal |author1=van der Vijver |author2=L. M. | title = Distribution of Plumbagin in the Plumbaginaceae | journal = Phytochemistry | year = 1972 | volume = 11 | issue = 11 | pages = 3247–3248 | doi = 10.1016/S0031-9422(00)86380-3 }}</ref>
It is also commonly found in the [[carnivorous plant]] genera ''[[Drosera]]'' and ''[[Nepenthes]]''.<ref>{{ cite journal |author1=Wang, W. |author2=Luo, X. |author3=Li, H. | title = Terahertz and Infrared Spectra of Plumbagin, Juglone, and Menadione | journal = [[Carnivorous Plant Newsletter]] | year = 2010 | volume = 39 | issue = 3 | pages = 82–88 }}</ref><ref name=Rischer>{{ cite journal |author1=Rischer, H. |author2=Hamm, A. |author3=Bringmann, G. | title = ''Nepenthes insignis'' Uses a C<sub>2</sub>-Portion of the Carbon Skeleton of L-Alanine Acquired via its Carnivorous Organs, to Build up the Allelochemical Plumbagin | journal = Phytochemistry | year = 2002 | volume = 59 | issue = 6 | pages = 603–609 | doi = 10.1016/S0031-9422(02)00003-1 |pmid=11867092 }}</ref> It is also a component of the [[Juglans nigra|black walnut]] drupe.

== See also ==
* [[Juglone]]

== References ==
{{reflist}}

[[Category:1,4-Naphthoquinones]]
[[Category:Hydroxynaphthoquinones]]