Jump to content

Fluoride phosphate

From Wikipedia, the free encyclopedia

This is the current revision of this page, as edited by Polygnotus (talk | contribs) at 22:54, 18 August 2024 (ccalculated → calculated). The present address (URL) is a permanent link to this version.

(diff) ← Previous revision | Latest revision (diff) | Newer revision → (diff)

The fluoride phosphates or phosphate fluorides are inorganic double salts that contain both fluoride and phosphate anions. In mineralogy, Hey's Chemical Index of Minerals groups these as 22.1. The Nickel-Strunz grouping is 8.BN.

Related mixed anion compounds are the chloride phosphates, the fluoride arsenates and fluoride vanadates.

They are distinct from the fluorophosphates: monofluorophosphate, difluorophosphate and hexafluorophosphate which have fluorine bonds to the phosphorus.

Minerals

[edit]
name formula ratio

PO4:F

formula weight crystal system space group unit cell volume density refractive index comment reference
Althausite Mg4(PO4)2(OH,O)(F,☐) 2:~1 Orthorhombic Pnma a = 8.258 b = 6.054, c = 14.383 719.06 2.97 Biaxial (+) nα = 1.588 nβ = 1.592 nγ = 1.598

2V: measured: 70° , calculated: 80°

Max birefringence: δ = 0.010

[1]
Amblygonite LiAl(PO4)F 1:1 Triclinic P1 a = 6.644 b = 7.744 c = 6.91

α = 90.35°, β = 117.33°, γ = 91.01° Z=4

315.75 3.04-3.11 Biaxial (-) nα = 1.577 - 1.591 nβ = 1.592 - 1.605 nγ = 1.596 - 1.613

2V: Measured: 107° to 129.5°

Birefringence: 0.020

[2]
aravaite Ba2Ca18(SiO4)6(PO4)3(CO3)F3O 3:3 trigonal R3m a = 7.1255, c = 66.290 Z=3 2914.8 [3]
Arctite Na2Ca4(PO4)3F 3:1 Trigonal R3m a = 7.078 c = 41.203 Z=6 1,787.64 3.13 Uniaxial (-) nω = 1.578 nε = 1.577 Birefringence: 0.001 [4]
Ariegilatite BaCa12(SiO4)4(PO4)2F2O Trigonal R3m a = 7.1551 c = 41.303 1381.2 Uniaxial (-) nω = 1.650 nε = 1.647

Max Birefringence: δ = 0.003

[5]
Babefphite BaBePO4(F,OH) 1:~1 Tetragonal Uniaxial (+) nω = 1.629 nε = 1.632

Max birefringence: δ = 0.003

[6]
Belovite-(Ce) NaCeSr3(PO4)3F 3:1 Trigonal P3 a = 9.692 c = 7.201 585.80 4.19 Uniaxial (-) nω = 1.653 - 1.660 nε = 1.634 - 1.640

Birefringence: 0.015

[7]
Belovite-(La) NaLaSr3(PO4)3F 3:1 Trigonal P3 a = 9.647 c = 7.17 577.88 4.19 Uniaxial (-) nω = 1.653 nε = 1.635 - 1.636

Max birefringence: δ = 0.018

[8]
Bøggildite Na2Sr2Al2PO4F9 1:9 Monoclinic Biaxial (+) nα = 1.462 nβ = 1.466 nγ = 1.469

2V: 80° Max birefringence:δ = 0.007

[9]
Carlgieseckeite-(Nd) NaNdCa3(PO4)3F Trigonal P3 a = 9.4553 c = 6.9825 540.62 3.91 [10]
Cloncurryite Cu0.5(VO)0.5Al2(PO4)2F2 · 5H2O 2:2 Monoclinic P21/b a = 4.9573 b = 12.1824 c = 18.9749 β = 90.933° Z=4 1145.78 2.525 Biaxial (-) nα = 1.548(2) nγ = 1.550(2)

2V: calculated: 56°

Max brefringence: δ = 0.002

[11]
Deloneite (Na0.5REE0.25Ca0.25)(Ca0.75REE0.25)Sr1.5(CaNa0.25REE0.25)(PO4)3F0.5(OH)0.5 Trigonal P3 a = 9.51 c = 7.01 Z=2 549.05 3.92 Uniaxial (-) nω = 1.682 nε = 1.660

Max birefringence: δ = 0.022

[12]
Fluellite Al2(PO4)F2(OH) · 7H2O Orthorhombic Fddd a = 11.22 b = 21.15 c = 8.54 2,027 2.139 - 2.17 Biaxial (+) nα = 1.473 - 1.490 nβ = 1.490 - 1.496 nγ = 1.506 - 1.511

Max birefringence: δ = 0.033

[13]
Fluorapatite Ca5(PO4)3F 3:1 Hexagonal P63/m a = 9.3973 c = 6.8782 526.03 3.1-3.25 Uniaxial (-) nω = 1.631 - 1.650 nε = 1.627 - 1.646

Birefringence: 0.004

[14]
Fluorcaphite SrCaCa3(PO4)3F 3:1 Hexagonal P63/m a = 9.485 c = 7.000 Z=2 545.39 Uniaxial (-) nω = 1.649 nε = 1.637

Max birefringence: δ = 0.012

[15]
Fluorphosphohedyphane Ca2Pb3(PO4)3F 3:1 Hexagonal P63/m a = 9.640, c = 7.012 Z=2 564.4 5.445 Uniaxial (-) nω = 1.836 nε = 1.824

Max birefringence: δ = 0.012

[16]
Fluorstrophite SrCaSr3(PO4)3F 3:1 Hexagonal P63/m a = 9.565 c = 7.115 Z=2 563.74 Uniaxial (-) nω = 1.651 nε = 1.637

Max birefringence: δ = 0.014

[17]
Francolite
Herderite CaBe(PO4)F Monoclinic a = 4.81, b = 7.7 c = 9.82 β = 90.1° 363.7 3.02 Biaxial (-) nα = 1.556 - 1.592 nβ = 1.578 - 1.610 nγ = 1.589 - 1.620

2V: calculated: 70°

Max birefringence: δ = 0.033

[18]
Iangreyite Ca2Al7(PO4)2(PO3OH)2(OH,F)15 · 8H2O 4:~15 Trigonal P3 2 1 a = 6.988 c = 16.707 706.5 [19]
Isokite CaMg(PO4)F Monoclinic B2/b a = 6.52 b = 8.75 c = 7.51 β = 121.47° 365.4 3.15-3.27 Biaxial (+) nα = 1.590 nβ = 1.595 nγ = 1.615

2V: ,easured: 51°

Max birefringence: δ = 0.025

[20]
Kingite Al3(PO4)2F2(OH) · 7H2O 2:2 Triclinic a = 9.15 b = 10 c = 7.24

α = 98.6°, β = 93.6°, γ = 93.2°

Biaxial [21]
Kuannersuite-(Ce) NaCeBa3(PO4)3F0.5Cl0.5 6:1 Trigonal P3 a = 9.909 c = 7.402 629.42 4.51 [22]
Lacroixite NaAl(PO4)F 1:1 Monoclinic B2/b a = 6.414 b = 8.207 c = 6.885 β = 115.47° 327.20 3.126 - 3.29 Biaxial (-) nα = 1.546 nβ = 1.563 nγ = 1.580

2V: measured: 89°

Birefringence: 0.034

[23]
Mcauslanite Fe3Al2(PO4)3(PO3OH)F · 18H2O 4:1 Triclinic a = 10.05 b = 11.56 c = 6.88

α = 105.84°, β = 93.66°, γ = 106.47°

728.7 Biaxial (-) nα = 1.522 nβ = 1.531 nγ = 1.534

2V: measured: 55° to 59.7°, calculated: 58°

Max birefringence:δ = 0.012

[24]
Minyulite KAl2(PO4)2(OH,F) · 4H2O 2:~1 Orthorhombic Pba2 a = 9.34 b = 9.74 c = 5.52 502 2.47 Biaxial (+) nα = 1.531 nβ = 1.534 nγ = 1.538

2V: measured: 70° , calculated: 82°

Max birefringence: δ = 0.007

[25]
Miyahisaite (Sr,Ca)2Ba3(PO4)3F 3:1 Hexagonal P63/m a = 9.921, c = 7.469 Z=2 636.7 4.511 [26]
Morinite NaCa2Al2(PO4)2(OH)F4 · 2H2O 2:4 Monoclinic 2.94 Biaxial (-) nα = 1.551 nβ = 1.563 nγ = 1.565

2V: measured: 43° , calculated: 44°

Max birefringence: δ = 0.014

[27]
Nacaphite Na2Ca(PO4)F Monoclinic P21/b a = 13.318 b = 7.0964 c = 10.6490 β = 113.526° Z=8 922.81 Biaxial (-) nα = 1.508 nβ = 1.515 nγ = 1.520

2V: 80° Max birefringence: δ = 0.012

[28]
natrophosphate Na7(PO4)2F.19H2O 2:1 Isometric Fd3c a = 27.79 Z=56 21,461.78 1,71-1.72 Isotropic [29][30]
Nefedovite Na5Ca4(PO4)4F 4:1 Triclinic a = 5.4 Å, b = 11.64 Å, c = 16.48 Å

α = 134.99°, β = 90.04°, γ = 89.96°

732.60 Biaxial (+) nα = 1.571 nγ = 1.590

Max birefringence: δ = 0.019

[31]
Nevadaite (Cu2+,Al,V3+)6Al8(PO4)8F8(OH)2 · 22H2O 8:8 Orthorhombic P21mn a = 12.123 b = 18.999 c = 4.961 2.54 Biaxial (-) nα = 1.540 nβ = 1.548 nγ = 1.553

2V: measured: 76°, calculated: 76°

Max birefringence: δ = 0.013

[32]
Panasqueiraite CaMg(PO4)(OH,F) 1:~1 monoclinic a = 6.53 b = 8.75 c = 6.91 β = 112.33° 365.2 3.27 Biaxial (+) nα = 1.590 nβ = 1.596 nγ = 1.616

2V: measured: 51° , calculated: 58°

Max birefringence: δ = 0.026

[33]
Richellite CaFe3+2(PO4)2(OH,F)2 2:~2 a = 5.18 c = 12.61 [34]
Stronadelphite Sr5(PO4)3F 3:1 Hexagonal P63/m a = 9.845 c = 7.383 619.72 Uniaxial (-) nω = 1.630(1) nε = 1.623(1)

Max birefringence: δ = 0.007

[35]
Triplite Mn2+2(PO4)F 1:1 Monoclinic P21/b a = 11.9 b = 6.52 c = 10.09 β = 105.62° 758.4 3.9 Biaxial (+) nα = 1.650 nβ = 1.660 nγ = 1.680

2V: measured: 70° to 90°, calculated: 72°

Max birefringence: δ = 0.030

[36]
Väyrynenite Mn2+Be(PO4)(OH,F) 1:~1 Monoclinic P21/b a = 5.411 b = 14.49 c = 4.73 β = 102.75° 361.71 3.22 Biaxial (-) nα = 1.638 - 1.640 nβ = 1.658 - 1.662 nγ = 1.664 - 1.667

2V: measured: 46° to 55°, Calculated: 51° to 57°

Max birefringence: δ = 0.026 - 0.027

[37]
Viitaniemiite Na(Ca,Mn2+)Al(PO4)(F,OH)3 1:~3 Monoclinic a = 6.83 b = 7.14 c = 5.44 β = 109.37° 250.27 Biaxial (-) nα = 1.557 nβ = 1.565 nγ = 1.571

2V: measured: 81° , calculated: 80°

Max birefringence: δ = 0.014

[38]
Wagnerite (Mg,Fe2+)2(PO4)F 1:1 Monoclinic P21/b a = 9.645 b = 31.659 c = 11.914 β = 108.26(3)° 3454.8 3.15 Biaxial (+) nα = 1.568 nβ = 1.572 nγ = 1.582

2V: Measured: 25° to 35°

? Birefringence:0.046

Max birefringence: δ = 0.015

[39]
Wavellite Al3(PO4)2(OH,F)3 · 5H2O 2:~3 Orthorhombic a = 9.621 b = 17.363 c = 6.994 1168.3 2.36 Biaxial (+) nα = 1.518 - 1.535 nβ = 1.524 - 1.543 nγ = 1.544 - 1.561

2V: measured: 60° to 72°, calculated: 60° to 70°

Max birefringence: δ = 0.026

[40]
Zwieselite Fe2+2(PO4)F 1:1 Monoclinic P21/b 753.82 Biaxial (+) nα = 1.686 - 1.696 nβ = 1.690 - 1.704 nγ = 1.703 - 1.713

2V: measured: 58° , calculated: 60°

Max birefringence: δ = 0.017

[41]
Na5-4.5PO4(CO3,F,Cl) 1:~1 [29]

Artificial

[edit]
name formula formula weight crystal system space group unit cell Å volume density refractive index comment reference
EMM-9; 4-(dimethylamino)pyridine fluoroaluminophosphate (DMAP)2Al4P4O17F2•H2O monoclinic P21/a a=14.335 b=13.561 c=14.497 β =101.094° layered [42]
KBPO4F monoclinic Cc [43]
Iron-Doped Sodium–Vanadium Fluorophosphate Na3V2–yO2–yFey(PO4)2F1+y (y < 0.3) tetrahedral P42/mnm a=9.0277 c=10.6259 866.0 [44]
Na3V2O1.6(PO4)2F1.4 [44]
Na3V2(PO4)2F3 [45]
Na2MnPO4F [46]
α Na2FePO4F monoclinic P21/c a = 13.675, b = 5.2503, c = 13.7202, β = 120.230° [46]
β Na2FePO4F orthorhombic [46]
RbBPO4F 210.25 cubic P213 a=7.5901 Z=4 437.26 3.194 colourless [43]
MIL-145 RbGa3(PO4)2(HPO4)F4·C5N2H16·2H2O 3187.11 monoclinic P2 a=14.4314 b=9.1152 c=16.7889 β = 112.708 Z=1 2037.30 2.598 colourless [47]
K2SnPO4F3 348.86 monoclinic P21/c a=10.039 b=9.415 c=21.602 beta=95.464 Z=12 2032.6 3.420 colourless [48]
K6Sn(P2O7)2F2 739.17 monoclinic P21/c a=8.515 b=12.400 c=8.403 beta=99.58 Z=29 874.8 2.806 colourless [48]
K2Sb(P2O7)F tetragonal P4bm a=8.5239 c=5.572 Z=2 404.8 3.223 colourless SHG 4.0×KDP [49]
CsBPO4F cubic P213 a=7.7090 Z=4 458.14 3.736 colourless [43]
Na2PrF2(PO4) cubic [50]
Na2NdF2(PO4) cubic [50]
Na2SmF2(PO4) cubic [50]
Na2EuF2(PO4) cubic [50]
Na2TbF2(PO4) cubic [50]
Na2PrF2(PO4) cubic [50]
PbZn(PO4)F 386.53 orthorhombic Pna21 a=8.985 b=9.381 c=4.8212 Z=4 406.4 6.318 colourless [51]

References

[edit]
  1. ^ "Althausite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  2. ^ "Amblygonite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  3. ^ Krüger, Biljana; Krüger, Hannes; Galuskin, Evgeny V.; Galuskina, Irina O.; Vapnik, Yevgeny; Olieric, Vincent; Pauluhn, Anuschka (2018-12-01). "Aravaite, Ba 2 Ca 18 (SiO 4 ) 6 (PO 4 ) 3 (CO 3 )F 3 O: modular structure and disorder of a new mineral with single and triple antiperovskite layers". Acta Crystallographica Section B. 74 (6): 492–501. Bibcode:2018AcCrB..74..492K. doi:10.1107/S2052520618012271. ISSN 2052-5206. S2CID 104301273.
  4. ^ "Arctite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  5. ^ "Ariegilatite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  6. ^ "Babefphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  7. ^ "Belovite-(Ce): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  8. ^ "Belovite-(La): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  9. ^ "Bøggildite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  10. ^ "Carlgieseckeite-(Nd): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  11. ^ "Cloncurryite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
  12. ^ "Deloneite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  13. ^ "Fluellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  14. ^ "Fluorapatite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  15. ^ "Fluorcaphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  16. ^ "Fluorphosphohedyphane: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  17. ^ "Fluorstrophite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  18. ^ "Herderite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  19. ^ "Iangreyite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  20. ^ "Isokite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  21. ^ "Kingite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
  22. ^ "Kuannersuite-(Ce): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  23. ^ "Lacroixite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  24. ^ "Mcauslanite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  25. ^ "Minyulite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  26. ^ "Miyahisaite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  27. ^ "Morinite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  28. ^ "Nacaphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  29. ^ a b Mitchell, R. H. (5 July 2018). "An ephemeral pentasodium phosphate carbonate from natrocarbonatite lapilli, Oldoinyo Lengai, Tanzania". Mineralogical Magazine. 70 (2): 211–218. doi:10.1180/0026461067020326. S2CID 140140550.
  30. ^ "Natrophosphate: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  31. ^ "Nefedovite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  32. ^ "Nevadaite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
  33. ^ "Panasqueiraite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  34. ^ "Richellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  35. ^ "Stronadelphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  36. ^ "Triplite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  37. ^ "Väyrynenite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  38. ^ "Viitaniemiite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  39. ^ "Wagnerite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  40. ^ "Wavellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
  41. ^ "Zwieselite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
  42. ^ Guo, Peng; Afeworki, Mobae; Cao, Guang; Yun, Yifeng; Sun, Junliang; Su, Jie; Wan, Wei; Zou, Xiaodong (2018-09-17). "Synthesis and Structure of a Layered Fluoroaluminophosphate and Its Transformation to a Three-Dimensional Zeotype Framework". Inorganic Chemistry. 57 (18): 11753–11760. doi:10.1021/acs.inorgchem.8b01890. ISSN 0020-1669.
  43. ^ a b c Ding, Qingran; Zhao, Sangen; Li, Lina; Shen, Yaoguo; Shan, Pai; Wu, Zhenyue; Li, Xianfeng; Li, Yanqiang; Liu, Shuai; Luo, Junhua (2019-02-04). "Abrupt Structural Transformation in Asymmetric ABPO 4 F (A = K, Rb, Cs)". Inorganic Chemistry. 58 (3): 1733–1737. doi:10.1021/acs.inorgchem.8b02754. ISSN 0020-1669.
  44. ^ a b Palomares, Verónica; Iturrondobeitia, Amaia; Sanchez-Fontecoba, Paula; Goonetilleke, Damian; Sharma, Neeraj; Lezama, Luis; Rojo, Teófilo (16 December 2019). "Iron-Doped Sodium–Vanadium Fluorophosphates: Na3V2–yO2–yFey(PO4)2F1+y (y < 0.3)". Inorganic Chemistry. 59 (1): 854–862. doi:10.1021/acs.inorgchem.9b03111. PMID 31840984. S2CID 209384135.
  45. ^ Semykina, Daria O.; Sharafutdinov, Marat R.; Kosova, Nina V. (2022-06-24). "Understanding of the Mechanism and Kinetics of the Fast Solid-State Reaction between NaF and VPO 4 to Form Na 3 V 2 (PO 4 ) 2 F 3". Inorganic Chemistry. 61 (26): 10023–10035. doi:10.1021/acs.inorgchem.2c00951. ISSN 0020-1669. PMID 35748412. S2CID 249989441.
  46. ^ a b c Kirsanova, Maria A.; Akmaev, Alexey S.; Aksyonov, Dmitry A.; Ryazantsev, Sergey V.; Nikitina, Victoria A.; Filimonov, Dmitry S.; Avdeev, Maxim; Abakumov, Artem M. (2020-11-16). "Monoclinic α-Na 2 FePO 4 F with Strong Antisite Disorder and Enhanced Na + Diffusion". Inorganic Chemistry. 59 (22): 16225–16237. doi:10.1021/acs.inorgchem.0c01961. ISSN 0020-1669. PMID 33137251. S2CID 226241204.
  47. ^ Martineau, Charlotte; Loiseau, Thierry; Beitone, Lionel; Férey, Gérard; Bouchevreau, Boris; Taulelle, Francis (2013). "Single-crystal XRD and solid-state NMR structural resolution of a layered fluorinated gallium phosphate: RbGa 3 (PO 4 ) 2 (HPO 4 )F 4 ·C 5 N 2 H 16 ·2H 2 O (MIL-145)". Dalton Trans. 42 (2): 422–431. doi:10.1039/C2DT31464A. ISSN 1477-9226. PMID 23069866.
  48. ^ a b Hu, Shuaishuai; Su, Zhi (2019). "Two new tin( iv )-containing phosphate fluorides with two types of Sn( iv )–P–O–F frameworks and short cutoff edges". New Journal of Chemistry. 43 (41): 16127–16130. doi:10.1039/C9NJ04424H. ISSN 1144-0546. S2CID 203137437.
  49. ^ Deng, Yalan; Huang, Ling; Dong, Xuehua; Wang, Lei; Ok, Kang Min; Zeng, Hongmei; Lin, Zhien; Zou, Guohong (2020-11-16). "K 2 Sb(P 2 O 7 )F: Cairo Pentagonal Layer with Bifunctional Genes Reveal Optical Performance". Angewandte Chemie International Edition. 59 (47): 21151–21156. doi:10.1002/anie.202009441. ISSN 1433-7851. PMID 32745331. S2CID 250308476.
  50. ^ a b c d e f Zimina, G. V.; Smirnova, I. N.; Gorkovenko, M. Yu.; Spiridonov, F. M.; Komissarova, L. N.; Kaloev, N. I. (1995-02-21). "ChemInform Abstract: Synthesis and Studies of Fluorophosphates of Rare Earth Elements Na2LnF2PO4". ChemInform. 26 (8). doi:10.1002/chin.199508015. ISSN 0931-7597.
  51. ^ li, xiaobao; Hu, Chun-Li; Kong, Fang; Mao, Jiang-Gao (2023). "Structure and Optical Property Evolutions in PbM(PO4)X (M = Zn, Sn; X = halogen): SHG Effect and Birefringence". Inorganic Chemistry Frontiers. 10 (8): 2268–2275. doi:10.1039/D3QI00230F. ISSN 2052-1553. S2CID 257419074.